Products 2767581-02-0
CAS 2767581-02-0 is the registry number for 6-Hydroxy-2,7-dimethylquinazolin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-hydroxy-2,7-dimethyl-3H-quinazolin-4-one (CAS 2767581-02-0) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 6-hydroxy-2,7-dimethyl-3H-quinazolin-4-one. InChIKey: CSZPCNFEKXUSFN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 6-hydroxy-2,7-dimethyl-3H-quinazolin-4-one |
| InChIKey | CSZPCNFEKXUSFN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1O)C(=O)NC(=N2)C |
Computed by PubChem (NCBI)