Products 2768090-43-1
CAS 2768090-43-1 is the registry number for Methyl 2-(chloromethyl)-1-[(2S)-2-oxetanylmethyl]-1H-benzimidazole-5-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 2-(chloromethyl)-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate (CAS 2768090-43-1) is a chemical compound with the molecular formula C14H15ClN2O3 and a molecular weight of 294.73 g/mol. IUPAC name: methyl 2-(chloromethyl)-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate. InChIKey: HANRGHQOSMOYOX-JTQLQIEISA-N.
| Molecular formula | C14H15ClN2O3 |
|---|---|
| Molecular weight | 294.73 g/mol |
| IUPAC name | methyl 2-(chloromethyl)-1-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate |
| InChIKey | HANRGHQOSMOYOX-JTQLQIEISA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N(C(=N2)CCl)C[C@@H]3CCO3 |
Computed by PubChem (NCBI)