Products 2768535-75-5

CAS 2768535-75-5 is the registry number for 3-Formyl-2-methoxyphenyl pivalate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3-formyl-2-methoxyphenyl) 2,2-dimethylpropanoate (CAS 2768535-75-5) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: (3-formyl-2-methoxyphenyl) 2,2-dimethylpropanoate. InChIKey: MMHJVBCUVAJUNI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O4
Molecular weight236.26 g/mol
IUPAC name(3-formyl-2-methoxyphenyl) 2,2-dimethylpropanoate
InChIKeyMMHJVBCUVAJUNI-UHFFFAOYSA-N
SMILESCC(C)(C)C(=O)OC1=CC=CC(=C1OC)C=O

Computed by PubChem (NCBI)