Products 276856-55-4
CAS 276856-55-4 is the registry number for Cryptomoscatone d2. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, Get quote.
(2R)-2-[(E,2R,4R)-2,4-dihydroxy-6-phenylhex-5-enyl]-2,3-dihydropyran-6-one (CAS 276856-55-4) is a chemical compound with the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. IUPAC name: (2R)-2-[(E,2R,4R)-2,4-dihydroxy-6-phenylhex-5-enyl]-2,3-dihydropyran-6-one. InChIKey: GOQOIZFMLWZVMB-GLBZDCTLSA-N.
| Molecular formula | C17H20O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | (2R)-2-[(E,2R,4R)-2,4-dihydroxy-6-phenylhex-5-enyl]-2,3-dihydropyran-6-one |
| InChIKey | GOQOIZFMLWZVMB-GLBZDCTLSA-N |
| SMILES | C1C=CC(=O)O[C@H]1C[C@@H](C[C@H](/C=C/C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)