Products 276861-63-3
CAS 276861-63-3 appears in our catalog under these names: 3–Methoxy–4–(trifluoromethyl)benzoic acid, 3-Methoxy-4-(trifluoromethyl)benzoic acid, 3-METHOXY-4-TRIFLUOROMETHYLBENZOIC ACID, 98%, 3-Methoxy-4-(trifluoromethyl)benzoic acid 95%, 3-Methoxy-4-(trifluoromethyl)benzoic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 250mg.
3-methoxy-4-(trifluoromethyl)benzoic acid (CAS 276861-63-3) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 3-methoxy-4-(trifluoromethyl)benzoic acid. InChIKey: HBMINIVKUUVKEB-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 3-methoxy-4-(trifluoromethyl)benzoic acid |
| InChIKey | HBMINIVKUUVKEB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)