Products 2768833-35-6
CAS 2768833-35-6 appears in our catalog under these names: NF–κB–IN–11, NF-κB-IN-11, 98.42%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 5 mg, 10mM/1mL, 100 mg, 10 mg.
Dimethyl 5-[2-(4-methylphenyl)ethynyl]-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate (CAS 2768833-35-6) is a chemical compound with the molecular formula C19H18O5 and a molecular weight of 326.3 g/mol. IUPAC name: dimethyl 5-[2-(4-methylphenyl)ethynyl]-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate. InChIKey: BQPRNEUDRHTCCF-UHFFFAOYSA-N.
| Molecular formula | C19H18O5 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | dimethyl 5-[2-(4-methylphenyl)ethynyl]-7-oxabicyclo[2.2.1]hept-2-ene-2,3-dicarboxylate |
| InChIKey | BQPRNEUDRHTCCF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C#CC2CC3C(=C(C2O3)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
NF-kappaB-IN-11, orb1944194