Products 2768870-96-6
CAS 2768870-96-6 is the registry number for 2,4-Dichloro-3,7,7-trimethyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridine (CAS 2768870-96-6) is a chemical compound with the molecular formula C11H13Cl2NO and a molecular weight of 246.13 g/mol. IUPAC name: 2,4-dichloro-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridine. InChIKey: DJOMEKPCYZZHOH-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 2,4-dichloro-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridine |
| InChIKey | DJOMEKPCYZZHOH-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(CC(OC2)(C)C)N=C1Cl)Cl |
Computed by PubChem (NCBI)