CAS 2768871-19-6 is the registry number for 3-Fluoro-7,7-dimethyl-1,5,7,8-tetrahydro-2H-pyrano[4,3-b]pyridin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-7,7-dimethyl-5,8-dihydro-1H-pyrano[4,3-b]pyridin-2-one (CAS 2768871-19-6) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: 3-fluoro-7,7-dimethyl-5,8-dihydro-1H-pyrano[4,3-b]pyridin-2-one. InChIKey: HBGIKMWKCZMMCX-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 3-fluoro-7,7-dimethyl-5,8-dihydro-1H-pyrano[4,3-b]pyridin-2-one |
| InChIKey | HBGIKMWKCZMMCX-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(CO1)C=C(C(=O)N2)F)C |
Computed by PubChem (NCBI)