CAS 2772689-48-0 is the registry number for 4-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-7H-PYRROLO[2,3-D]PYRIMIDINE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-7H-pyrrolo[2,3-d]pyrimidine (CAS 2772689-48-0) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: SWWNAGUZQPIGNA-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | SWWNAGUZQPIGNA-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=C4C=CNC4=NC=N3 |
Computed by PubChem (NCBI)