Products 2773324-48-2
CAS 2773324-48-2 is the registry number for 2-Fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 97%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2773324-48-2) is a chemical compound with the molecular formula C13H18BFO3 and a molecular weight of 252.09 g/mol. IUPAC name: 2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: RBLXWFSZYDOHJS-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | 2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | RBLXWFSZYDOHJS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2C)O)F |
Computed by PubChem (NCBI)