CAS 2775-87-3 appears in our catalog under these names: 3–Benzoylpyrimidine–2，4(1H，3H)–dione, 3-Benzoyl-1H-pyrimidine-2,4-dione, 3-Benzoylpyrimidine-2,4(1H,3H)-dione, 95%, 3-Benzoylpyrimidine-2,4(1H,3H)-dione, 98%, 3-Benzoylpyrimidine-2,4(1H,3H)-Dione, 98%, 98%. Offered by: GLPBio, Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg.
3-benzoyl-1H-pyrimidine-2,4-dione (CAS 2775-87-3) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 3-benzoyl-1H-pyrimidine-2,4-dione. InChIKey: RJAJHSYADHZMNA-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 3-benzoyl-1H-pyrimidine-2,4-dione |
| InChIKey | RJAJHSYADHZMNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N2C(=O)C=CNC2=O |
Computed by PubChem (NCBI)