CAS 27826-42-2 is the registry number for Benzene, 1-nitro-4-(propylthio)-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-nitro-4-propylsulfanylbenzene (CAS 27826-42-2) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 1-nitro-4-propylsulfanylbenzene. InChIKey: ZKRRTBXZRJXUJO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 1-nitro-4-propylsulfanylbenzene |
| InChIKey | ZKRRTBXZRJXUJO-UHFFFAOYSA-N |
| SMILES | CCCSC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)