Products 27862-85-7
CAS 27862-85-7 is the registry number for Lurasidone Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
Bicyclo[2.2.1]heptane-2,3-dicarboxylic acid (CAS 27862-85-7) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: bicyclo[2.2.1]heptane-2,3-dicarboxylic acid. InChIKey: IVVOCRBADNIWDM-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | bicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| InChIKey | IVVOCRBADNIWDM-UHFFFAOYSA-N |
| SMILES | C1CC2CC1C(C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,3-Norbornanedicarboxylic Acid, bicyclo[2.2.1]heptane-2,3-dicarboxylic acid, Dihydronadic acid, endo,endo-2,3-Norbornanedicarboxylic acid, Bicyclo[2.2.1]heptane-2,3-dicarboxylicacid, 2,3-Norbornanedicarboxylic acid, endo,endo-, Maybridge4_000592, Oprea1_379166, norbornane-2,3-dicarboxylic acid, trans-2,3-norbornanedicarboxylic acid