Products 2788-74-1
CAS 2788-74-1 appears in our catalog under these names: 4-(Ethylamino)-3-nitrobenzoic acid, 95%, 4-(Ethylamino)-3-nitrobenzoic acid, 95+%, 4-(Ethylamino)-3-nitrobenzoic acid, 4-(Ethylamino)-3-nitrobenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Dr. Ehrenstorfer, Biosynth, Chemat. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 50mg, 0,5g.
4-(ethylamino)-3-nitrobenzoic acid (CAS 2788-74-1) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 4-(ethylamino)-3-nitrobenzoic acid. InChIKey: XPLTXYDVYDWSSO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 4-(ethylamino)-3-nitrobenzoic acid |
| InChIKey | XPLTXYDVYDWSSO-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-(ethylamino)-3-nitrobenzoic acid, N-Ethyl-3-nitro PABA, 4-Ethylamino-3-nitrobenzoic acid, Benzoic acid, 4-(ethylamino)-3-nitro-, N-Ethyl-3-nitro para amino benzoic acid, N-Ethyl-3-nitro PABA [INCI], 4-Ethylamino-3-nitro-benzoic acid, 4-(Ethylamino)-3-nitro-benzoic acid, Oprea1_079078, 4-(Ethylamino)-3-nitrobenzoicacid