CAS 2791314-17-3 is the registry number for 1-(4-Chloro-5-methoxy-6-methylpyridin-2-yl)-2,2,2-trifluoroethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chloro-5-methoxy-6-methyl-2-pyridinyl)-2,2,2-trifluoroethanone (CAS 2791314-17-3) is a chemical compound with the molecular formula C9H7ClF3NO2 and a molecular weight of 253.60 g/mol. IUPAC name: 1-(4-chloro-5-methoxy-6-methyl-2-pyridinyl)-2,2,2-trifluoroethanone. InChIKey: FASXEIQZSZMXOS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO2 |
|---|---|
| Molecular weight | 253.60 g/mol |
| IUPAC name | 1-(4-chloro-5-methoxy-6-methyl-2-pyridinyl)-2,2,2-trifluoroethanone |
| InChIKey | FASXEIQZSZMXOS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=N1)C(=O)C(F)(F)F)Cl)OC |
Computed by PubChem (NCBI)