Products 2791448-86-5

CAS 2791448-86-5 is the registry number for 5-(Benzyloxy)-2-methoxynicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methoxy-5-phenylmethoxypyridine-3-carboxylic acid (CAS 2791448-86-5) is a chemical compound with the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. IUPAC name: 2-methoxy-5-phenylmethoxypyridine-3-carboxylic acid. InChIKey: SYFGPXYLVGONSH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13NO4
Molecular weight259.26 g/mol
IUPAC name2-methoxy-5-phenylmethoxypyridine-3-carboxylic acid
InChIKeySYFGPXYLVGONSH-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=N1)OCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)