Products 279262-35-0
CAS 279262-35-0 appears in our catalog under these names: 4-(3-methoxypropoxy)phenylboronic acid, 98%, 4-(3-Methoxypropoxy)phenylboronic acid, 95-<97%, 4-(3-Methoxypropoxy)phenylboronic acid, ≥97-<99%, (4-(3-Methoxypropoxy)phenyl)boronic acid, 98%, (4–(3–Methoxypropoxy)phenyl)boronic acid. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 10g, 25g, 50g, 100g, 200g, 300g.
[4-(3-methoxypropoxy)phenyl]boronic acid (CAS 279262-35-0) is a chemical compound with the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. IUPAC name: [4-(3-methoxypropoxy)phenyl]boronic acid. InChIKey: WYIXRPIOLPCEBP-UHFFFAOYSA-N.
| Molecular formula | C10H15BO4 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | [4-(3-methoxypropoxy)phenyl]boronic acid |
| InChIKey | WYIXRPIOLPCEBP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCCOC)(O)O |
Computed by PubChem (NCBI)