Products 279263-10-4
CAS 279263-10-4 appears in our catalog under these names: 4-Ethoxy-3-fluorophenylboronic acid 98%, 4-Ethoxy-3-fluorobenzeneboronic acid, 98%, 4-Ethoxy-3-fluorophenylboronic acid, 98%, 98%, 4–Ethoxy–3–fluorophenylboronic Acid (contains varying amounts of Anhydride), 4-Ethoxy-3-fluorophenylboronic Acid (contains varying amounts of Anhydride). Offered by: Ambeed, Fluorochem, Chemat, GLPBio, TCI. Available pack sizes: 5g, 10g, 25g, 100g, 1g.
(4-ethoxy-3-fluorophenyl)boronic acid (CAS 279263-10-4) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: (4-ethoxy-3-fluorophenyl)boronic acid. InChIKey: ZONJMULNQBNBGU-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | (4-ethoxy-3-fluorophenyl)boronic acid |
| InChIKey | ZONJMULNQBNBGU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-ethoxy-3-fluorophenyl)boronic acid, 4-Ethoxy-3-fluorophenylboronic acid, 4-Ethoxy-3-fluorobenzeneboronic acid, Boronic acid, (4-ethoxy-3-fluorophenyl)-, 4-Ethoxy-3-fluorophenylboronic Acid (contains varying amounts of Anhydride), 4-Ethoxy-3-fluorophenylboronicacid, (4-ethoxy-3-fluoro-phenyl)boronic Acid, 3-fluoro-4-ethoxyphenyl boronic acid, (4-ethoxy-3-fluoro)phenylboronic acid, 3-fluoro-4-ethoxyphenylboronic aci