CAS 2802898-41-3 is the registry number for Citrinin 13C13 10 μg/mL in Acetonitrile. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1,2ml.
(3R,4S)-6-hydroxy-3,4,5-tri((113C)methyl)-8-oxo-3,4-dihydroisochromene-7-carboxylic acid (CAS 2802898-41-3) is a chemical compound with the molecular formula C13H14O5 and a molecular weight of 263.15 g/mol. IUPAC name: (3R,4S)-6-hydroxy-3,4,5-tri((113C)methyl)-8-oxo-3,4-dihydroisochromene-7-carboxylic acid. InChIKey: CBGDIJWINPWWJW-DZIGRXTASA-N.
| Molecular formula | C13H14O5 |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | (3R,4S)-6-hydroxy-3,4,5-tri((113C)methyl)-8-oxo-3,4-dihydroisochromene-7-carboxylic acid |
| InChIKey | CBGDIJWINPWWJW-DZIGRXTASA-N |
| SMILES | [13CH3][13C@@H]1[13C@H](O[13CH]=[13C]2[13C]1=[13C]([13C](=[13C]([13C]2=O)[13C](=O)O)O)[13CH3])[13CH3] |
Computed by PubChem (NCBI)