Products 2803375-51-9
CAS 2803375-51-9 appears in our catalog under these names: tert-Butyl (3-bromo-5-chloro-2-fluorophenyl)carbamate, 98%, 98%, Carfizomib impurity 20, 99.77%. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 1 mg, 5 mg.
(2R)-2-amino-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one;2,2,2-trifluoroacetic acid (CAS 2803375-51-9) is a chemical compound with the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. IUPAC name: (2R)-2-amino-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one;2,2,2-trifluoroacetic acid. InChIKey: OWGGQBZQMQMPBI-PRCZDLBKSA-N.
| Molecular formula | C11H18F3NO4 |
|---|---|
| Molecular weight | 285.26 g/mol |
| IUPAC name | (2R)-2-amino-4-methyl-1-[(2R)-2-methyloxiran-2-yl]pentan-1-one;2,2,2-trifluoroacetic acid |
| InChIKey | OWGGQBZQMQMPBI-PRCZDLBKSA-N |
| SMILES | CC(C)C[C@H](C(=O)[C@]1(CO1)C)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)