Products 1056467-60-7
CAS 1056467-60-7 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)–6,6,6–trifluorohexanoic acid, Boc-L-TfNle-OH. Offered by: GLPBio, Iris Biotech. Available pack sizes: 1g, on request.
(2S)-6,6,6-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 1056467-60-7) is a chemical compound with the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. IUPAC name: (2S)-6,6,6-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: IUCAIZFOVHKRTO-ZETCQYMHSA-N.
| Molecular formula | C11H18F3NO4 |
|---|---|
| Molecular weight | 285.26 g/mol |
| IUPAC name | (2S)-6,6,6-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | IUCAIZFOVHKRTO-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)