CAS 2242426-49-7 is the registry number for 2-((tert-Butoxycarbonyl)amino)-4,4,4-trifluoro-3,3-dimethylbutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4,4-trifluoro-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 2242426-49-7) is a chemical compound with the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. IUPAC name: 4,4,4-trifluoro-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: TYQRGOIPUSJXNX-UHFFFAOYSA-N.
| Molecular formula | C11H18F3NO4 |
|---|---|
| Molecular weight | 285.26 g/mol |
| IUPAC name | 4,4,4-trifluoro-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | TYQRGOIPUSJXNX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C(C)(C)C(F)(F)F |
Computed by PubChem (NCBI)