CAS 409333-67-1 appears in our catalog under these names: Boc-d,l-5,5,5-trifluoroleucine, 95%, 2-((tert-Butoxycarbonyl)amino)-5,5,5-trifluoro-4-methylpentanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5,5,5-trifluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 409333-67-1) is a chemical compound with the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. IUPAC name: 5,5,5-trifluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: PLTXZUYAJDKNFI-UHFFFAOYSA-N.
| Molecular formula | C11H18F3NO4 |
|---|---|
| Molecular weight | 285.26 g/mol |
| IUPAC name | 5,5,5-trifluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | PLTXZUYAJDKNFI-UHFFFAOYSA-N |
| SMILES | CC(CC(C(=O)O)NC(=O)OC(C)(C)C)C(F)(F)F |
Computed by PubChem (NCBI)