Products 1416444-73-9
CAS 1416444-73-9 is the registry number for (R)-2-((tert-Butoxycarbonyl)amino)-6,6,6-trifluorohexanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-6,6,6-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 1416444-73-9) is a chemical compound with the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. IUPAC name: (2R)-6,6,6-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: IUCAIZFOVHKRTO-SSDOTTSWSA-N.
| Molecular formula | C11H18F3NO4 |
|---|---|
| Molecular weight | 285.26 g/mol |
| IUPAC name | (2R)-6,6,6-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | IUCAIZFOVHKRTO-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)