CAS 343328-83-6 is the registry number for Boc-TfLeu-OH (4SR). Offered by: Iris Biotech. Available pack sizes: on request.
(2S)-5,5,5-trifluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 343328-83-6) is a chemical compound with the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. IUPAC name: (2S)-5,5,5-trifluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: PLTXZUYAJDKNFI-MLWJPKLSSA-N.
| Molecular formula | C11H18F3NO4 |
|---|---|
| Molecular weight | 285.26 g/mol |
| IUPAC name | (2S)-5,5,5-trifluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | PLTXZUYAJDKNFI-MLWJPKLSSA-N |
| SMILES | CC(C[C@@H](C(=O)O)NC(=O)OC(C)(C)C)C(F)(F)F |
Computed by PubChem (NCBI)