Products 280585-34-4
CAS 280585-34-4 is the registry number for Oxeglitazar. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E,4E)-5-(7-methoxy-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid (CAS 280585-34-4) is a chemical compound with the molecular formula C19H22O4 and a molecular weight of 314.4 g/mol. IUPAC name: (2E,4E)-5-(7-methoxy-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid. InChIKey: FVGXANXBVWECQE-BYWGDBCOSA-N.
| Molecular formula | C19H22O4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (2E,4E)-5-(7-methoxy-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid |
| InChIKey | FVGXANXBVWECQE-BYWGDBCOSA-N |
| SMILES | C/C(=C\C(=O)O)/C=C/C1=CC(COC2=C1C=C(C=C2)OC)(C)C |
Computed by PubChem (NCBI)