CAS 280752-79-6 appears in our catalog under these names: (7-Bromo-2,3-dihydrobenzo[b][1,4]dioxin-2-yl)methanol, 95%, 7-Bromo-2,3-dihydro-1,4-benzodioxin-2-methanol, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g.
(6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl)methanol (CAS 280752-79-6) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: (6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl)methanol. InChIKey: FJGPKNZNSQTEAL-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | (6-bromo-2,3-dihydro-1,4-benzodioxin-3-yl)methanol |
| InChIKey | FJGPKNZNSQTEAL-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(O1)C=CC(=C2)Br)CO |
Computed by PubChem (NCBI)