Products 2810-69-7
CAS 2810-69-7 appears in our catalog under these names: 1,2,3,4-Tetrabromo-5,6-dimethylbenzene, 95%, 95%, 1,2,3,4-Tetrabromo-5,6-dimethylbenzene, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1,2,3,4-tetrabromo-5,6-dimethylbenzene (CAS 2810-69-7) is a chemical compound with the molecular formula C8H6Br4 and a molecular weight of 421.75 g/mol. IUPAC name: 1,2,3,4-tetrabromo-5,6-dimethylbenzene. InChIKey: WVJRAJZMOVQFEC-UHFFFAOYSA-N.
| Molecular formula | C8H6Br4 |
|---|---|
| Molecular weight | 421.75 g/mol |
| IUPAC name | 1,2,3,4-tetrabromo-5,6-dimethylbenzene |
| InChIKey | WVJRAJZMOVQFEC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)Br)Br)Br)C |
Computed by PubChem (NCBI)
Synonyms:
Benzene, dimethyl-, tetrabromo deriv., O-TETRABROMOXYLENE, TETRABROMODIMETHYLBENZENE, 3,4,5,6-tetrabromo-1,2-dimethylbenzene, 1,2,3,4-tetrabromo-5,6-dimethylbenzene, Tetrabromo-o-xylene, Benzene, 1,2,3,4-tetrabromo-5,6-dimethyl-, Tetrabromo-ortho-xylene, Xylene, tetrabromo derivative, tetrabromoxylene