CAS 2812-40-0 is the registry number for N,N-Dimethyl-L-Tryptophan. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(dimethylamino)-3-(1H-indol-3-yl)propanoic acid (CAS 2812-40-0) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: (2S)-2-(dimethylamino)-3-(1H-indol-3-yl)propanoic acid. InChIKey: SOSHNYKNINOSTB-LBPRGKRZSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | (2S)-2-(dimethylamino)-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | SOSHNYKNINOSTB-LBPRGKRZSA-N |
| SMILES | CN(C)[C@@H](CC1=CNC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)