CAS 28123-72-0 appears in our catalog under these names: 2-(4-Nitrophenyl)furan, 95-<97%, 2-(4-Nitrophenyl)furan, 97%, 2-(4-Nitrophenyl)furan. Offered by: Hoffman Fine Chemicals, AmBeed, Biosynth. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g, 1g, 50mg.
2-(4-nitrophenyl)furan (CAS 28123-72-0) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-(4-nitrophenyl)furan. InChIKey: XQFDRMWXIPRVSO-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-(4-nitrophenyl)furan |
| InChIKey | XQFDRMWXIPRVSO-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)