CAS 2812355-75-0 is the registry number for 2-Chloro-7,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-7,7-dimethyl-5,6-dihydrocyclopenta[b]pyridin-4-amine (CAS 2812355-75-0) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 2-chloro-7,7-dimethyl-5,6-dihydrocyclopenta[b]pyridin-4-amine. InChIKey: PCCUCXRUCYBMTA-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-chloro-7,7-dimethyl-5,6-dihydrocyclopenta[b]pyridin-4-amine |
| InChIKey | PCCUCXRUCYBMTA-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C1N=C(C=C2N)Cl)C |
Computed by PubChem (NCBI)