CAS 28166-41-8 appears in our catalog under these names: Alpha-Cyano-4-hydroxycinnamic Acid, >95% (HPLC), a-Cyano-4-hydroxycinnamic Acid, >95% (HPLC), CHC, α-Cyano-4-hydroxycinnamic acid/ 99.8% (existing batch purity), alpha-Cyano-4-hydroxycinnamic acid, Ultrapure MALDI Matrix . Offered by: TRC, GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 2,5g, 5g, 100mg, 10mM (in 1ml dmso), 50mg, 200mg, 5x10mg.
2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid (CAS 28166-41-8) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid. InChIKey: AFVLVVWMAFSXCK-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid |
| InChIKey | AFVLVVWMAFSXCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=C(C#N)C(=O)O)O |
Computed by PubChem (NCBI)