CAS 281670-46-0 appears in our catalog under these names: Ampicillin Impurity 21, Ampicillin Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,6S)-3,6-diphenylpiperazine-2,5-dione (CAS 281670-46-0) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: (3S,6S)-3,6-diphenylpiperazine-2,5-dione. InChIKey: BMGJGWGTAAJISM-KBPBESRZSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (3S,6S)-3,6-diphenylpiperazine-2,5-dione |
| InChIKey | BMGJGWGTAAJISM-KBPBESRZSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]2C(=O)N[C@H](C(=O)N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)