Products 31485-02-6
CAS 31485-02-6 appears in our catalog under these names: Ampicillin EP Impurity G, (3R,6R)-3,6-Diphenyl-2,5-piperazinedione, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 25mg, 50mg.
(3R,6R)-3,6-diphenylpiperazine-2,5-dione (CAS 31485-02-6) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: (3R,6R)-3,6-diphenylpiperazine-2,5-dione. InChIKey: BMGJGWGTAAJISM-ZIAGYGMSSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | (3R,6R)-3,6-diphenylpiperazine-2,5-dione |
| InChIKey | BMGJGWGTAAJISM-ZIAGYGMSSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]2C(=O)N[C@@H](C(=O)N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
(3R,6R)-3,6-Diphenylpiperazine-2,5-dione, 3,6-Diphenylpiperazine-2,5-dione, (3R,6R)-, 2,5-Piperazinedione, 3,6-diphenyl-, D,D-, Ampicillin trihydrate impurity G [EP], 2,5-Piperazinedione, 3,6-diphenyl-, (3R,6R)-, Ampicillin, anhydrous impurity G [EP], AMPICILLIN TRIHYDRATE IMPURITY G [EP IMPURITY], AMPICILLIN, ANHYDROUS IMPURITY G [EP IMPURITY], AMPICILLIN TRIHYDRATE IMPURITY G (EP IMPURITY), AMPICILLIN, ANHYDROUS IMPURITY G (EP IMPURITY)