Products 2819093-06-4
CAS 2819093-06-4 is the registry number for 2-Hydroxy-4’,5-diacetamido-biphenyl. Offered by: TRC. Available pack sizes: 50mg.
N-[4-(4-acetamido-2-hydroxyphenyl)phenyl]acetamide (CAS 2819093-06-4) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: N-[4-(4-acetamido-2-hydroxyphenyl)phenyl]acetamide. InChIKey: OTMDWPFVRKLVKS-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | N-[4-(4-acetamido-2-hydroxyphenyl)phenyl]acetamide |
| InChIKey | OTMDWPFVRKLVKS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C2=C(C=C(C=C2)NC(=O)C)O |
Computed by PubChem (NCBI)