CAS 28198-29-0 is the registry number for 3-Phenylmethanesulfonylbenzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-benzylsulfonylbenzoic acid (CAS 28198-29-0) is a chemical compound with the molecular formula C14H12O4S and a molecular weight of 276.31 g/mol. IUPAC name: 3-benzylsulfonylbenzoic acid. InChIKey: WLBNVHKERLQFBI-UHFFFAOYSA-N.
| Molecular formula | C14H12O4S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | 3-benzylsulfonylbenzoic acid |
| InChIKey | WLBNVHKERLQFBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CS(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)