CAS 2820500-89-6 appears in our catalog under these names: 3-(7-Bromo-2H-indazol-2-yl)piperidine-2,6-dione, 98%, 3-(4-bromo-2H-indazol-2-yl)piperidine-2,6-dione, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g.
3-(4-bromoindazol-2-yl)piperidine-2,6-dione (CAS 2820500-89-6) is a chemical compound with the molecular formula C12H10BrN3O2 and a molecular weight of 308.13 g/mol. IUPAC name: 3-(4-bromoindazol-2-yl)piperidine-2,6-dione. InChIKey: ZLZOYAGEUKJGKZ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3O2 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 3-(4-bromoindazol-2-yl)piperidine-2,6-dione |
| InChIKey | ZLZOYAGEUKJGKZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C=C3C(=N2)C=CC=C3Br |
Computed by PubChem (NCBI)