CAS 2270905-19-4 is the registry number for 2-(4-Bromo-2-methoxy-phenyl)-5-methyl-imidazo[5,1-b][1,2,4]oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(4-bromo-2-methoxyphenyl)-5-methylimidazo[1,5-b][1,2,4]oxadiazole (CAS 2270905-19-4) is a chemical compound with the molecular formula C12H10BrN3O2 and a molecular weight of 308.13 g/mol. IUPAC name: 2-(4-bromo-2-methoxyphenyl)-5-methylimidazo[1,5-b][1,2,4]oxadiazole. InChIKey: SERHUEIKTHOKKS-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3O2 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 2-(4-bromo-2-methoxyphenyl)-5-methylimidazo[1,5-b][1,2,4]oxadiazole |
| InChIKey | SERHUEIKTHOKKS-UHFFFAOYSA-N |
| SMILES | CC1=NC=C2N1OC(=N2)C3=C(C=C(C=C3)Br)OC |
Computed by PubChem (NCBI)