Products 2913343-49-2
CAS 2913343-49-2 appears in our catalog under these names: 3-(5-bromo-1H-1,3-benzodiazol-1-yl)piperidine-2,6-dione, 95%, 95%, 3-(5-Bromo-1H-benzo[d]imidazol-1-yl)piperidine-2,6-dione, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-(5-bromobenzimidazol-1-yl)piperidine-2,6-dione (CAS 2913343-49-2) is a chemical compound with the molecular formula C12H10BrN3O2 and a molecular weight of 308.13 g/mol. IUPAC name: 3-(5-bromobenzimidazol-1-yl)piperidine-2,6-dione. InChIKey: ASVWXQLFZZUNHK-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3O2 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 3-(5-bromobenzimidazol-1-yl)piperidine-2,6-dione |
| InChIKey | ASVWXQLFZZUNHK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C=NC3=C2C=CC(=C3)Br |
Computed by PubChem (NCBI)