Products 2925072-41-7
CAS 2925072-41-7 is the registry number for 3-{6-bromoimidazo[1,2-a]pyridin-2-yl}piperidine-2,6-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(6-bromoimidazo[1,2-a]pyridin-2-yl)piperidine-2,6-dione (CAS 2925072-41-7) is a chemical compound with the molecular formula C12H10BrN3O2 and a molecular weight of 308.13 g/mol. IUPAC name: 3-(6-bromoimidazo[1,2-a]pyridin-2-yl)piperidine-2,6-dione. InChIKey: CKYBLDDNKNDPLD-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3O2 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 3-(6-bromoimidazo[1,2-a]pyridin-2-yl)piperidine-2,6-dione |
| InChIKey | CKYBLDDNKNDPLD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CN3C=C(C=CC3=N2)Br |
Computed by PubChem (NCBI)