Products 1496108-57-6

CAS 1496108-57-6 is the registry number for 1-(5-Bromopyridin-2-yl)-5-cyclopropyl-1h-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(5-bromo-2-pyridinyl)-5-cyclopropylpyrazole-4-carboxylic acid (CAS 1496108-57-6) is a chemical compound with the molecular formula C12H10BrN3O2 and a molecular weight of 308.13 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)-5-cyclopropylpyrazole-4-carboxylic acid. InChIKey: RNTHVQCHQHFTGM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BrN3O2
Molecular weight308.13 g/mol
IUPAC name1-(5-bromo-2-pyridinyl)-5-cyclopropylpyrazole-4-carboxylic acid
InChIKeyRNTHVQCHQHFTGM-UHFFFAOYSA-N
SMILESC1CC1C2=C(C=NN2C3=NC=C(C=C3)Br)C(=O)O

Computed by PubChem (NCBI)