Products 1133115-93-1
CAS 1133115-93-1 is the registry number for Methyl 2-amino-4-(3-bromophenyl)pyrimidine-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-amino-4-(3-bromophenyl)pyrimidine-5-carboxylate (CAS 1133115-93-1) is a chemical compound with the molecular formula C12H10BrN3O2 and a molecular weight of 308.13 g/mol. IUPAC name: methyl 2-amino-4-(3-bromophenyl)pyrimidine-5-carboxylate. InChIKey: CAXSHYMFYJLHSP-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3O2 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | methyl 2-amino-4-(3-bromophenyl)pyrimidine-5-carboxylate |
| InChIKey | CAXSHYMFYJLHSP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(N=C1C2=CC(=CC=C2)Br)N |
Computed by PubChem (NCBI)