CAS 2821786-58-5 is the registry number for (4-Chloropyrazolo[1,5-a]pyrazin-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chloropyrazolo[1,5-a]pyrazin-2-yl)methanol (CAS 2821786-58-5) is a chemical compound with the molecular formula C7H6ClN3O and a molecular weight of 183.59 g/mol. IUPAC name: (4-chloropyrazolo[1,5-a]pyrazin-2-yl)methanol. InChIKey: UPQHZAYXRXQGQK-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | (4-chloropyrazolo[1,5-a]pyrazin-2-yl)methanol |
| InChIKey | UPQHZAYXRXQGQK-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CC(=N2)CO)C(=N1)Cl |
Computed by PubChem (NCBI)