CAS 28232-53-3 is the registry number for 3-(4-Nitrophenoxy)pyridine, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 25g.
3-(4-nitrophenoxy)pyridine (CAS 28232-53-3) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 3-(4-nitrophenoxy)pyridine. InChIKey: BXRQEJKKEDDSBF-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 3-(4-nitrophenoxy)pyridine |
| InChIKey | BXRQEJKKEDDSBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)