Products 2827562-96-7
CAS 2827562-96-7 is the registry number for 3-(N-Boc-S-methylsulfonimidoyl)propanoic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-[S-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]sulfonimidoyl]propanoic acid (CAS 2827562-96-7) is a chemical compound with the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. IUPAC name: 3-[S-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]sulfonimidoyl]propanoic acid. InChIKey: FXTDVWBXRVWBLJ-UHFFFAOYSA-N.
| Molecular formula | C9H17NO5S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | 3-[S-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]sulfonimidoyl]propanoic acid |
| InChIKey | FXTDVWBXRVWBLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N=S(=O)(C)CCC(=O)O |
Computed by PubChem (NCBI)