Products 2828440-12-4
CAS 2828440-12-4 is the registry number for (3,5-Diamino-4-isobutylphenyl)boronic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
[3,5-diamino-4-(2-methylpropyl)phenyl]boronic acid (CAS 2828440-12-4) is a chemical compound with the molecular formula C10H17BN2O2 and a molecular weight of 208.07 g/mol. IUPAC name: [3,5-diamino-4-(2-methylpropyl)phenyl]boronic acid. InChIKey: OUEVJUPJROEIHF-UHFFFAOYSA-N.
| Molecular formula | C10H17BN2O2 |
|---|---|
| Molecular weight | 208.07 g/mol |
| IUPAC name | [3,5-diamino-4-(2-methylpropyl)phenyl]boronic acid |
| InChIKey | OUEVJUPJROEIHF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)N)CC(C)C)N)(O)O |
Computed by PubChem (NCBI)