Products 2828463-35-8
CAS 2828463-35-8 is the registry number for 5-Bromo-7-chloroisochromane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-7-chloro-3,4-dihydro-1H-isochromene (CAS 2828463-35-8) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 5-bromo-7-chloro-3,4-dihydro-1H-isochromene. InChIKey: AGPISSUQIMLLDT-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 5-bromo-7-chloro-3,4-dihydro-1H-isochromene |
| InChIKey | AGPISSUQIMLLDT-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1C(=CC(=C2)Cl)Br |
Computed by PubChem (NCBI)