CAS 28291-63-6 appears in our catalog under these names: Oxcarbazepine Impurity 11, 5-Acetyl-5,11-dihydro-10H-dibenz(b,f)azepin-10-one. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 500mg, 50mg, 100mg, 250mg.
11-acetyl-6H-benzo[b][1]benzazepin-5-one (CAS 28291-63-6) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 11-acetyl-6H-benzo[b][1]benzazepin-5-one. InChIKey: BVFWPQQJWYTKGK-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 11-acetyl-6H-benzo[b][1]benzazepin-5-one |
| InChIKey | BVFWPQQJWYTKGK-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=CC=CC=C2CC(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)