Products 2830009-63-5
CAS 2830009-63-5 is the registry number for (R)-Methyl 2-(4-bromophenyl)-2-(Boc-amino)acetate, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl (2R)-2-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (CAS 2830009-63-5) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: methyl (2R)-2-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate. InChIKey: WBOPTLASVNELEY-LLVKDONJSA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | methyl (2R)-2-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| InChIKey | WBOPTLASVNELEY-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC=C(C=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)