CAS 28311-43-5 is the registry number for Baclofen Impurity 11 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3-(4-hydroxyphenyl)butanoic acid;hydrochloride (CAS 28311-43-5) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: 4-amino-3-(4-hydroxyphenyl)butanoic acid;hydrochloride. InChIKey: KQWTZYLBZJNKLH-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | 4-amino-3-(4-hydroxyphenyl)butanoic acid;hydrochloride |
| InChIKey | KQWTZYLBZJNKLH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)CN)O.Cl |
Computed by PubChem (NCBI)